C29H26BIrN2O2- — CID 166020390
4-[10-(2,6-dimethylphenyl)-3H-benzo[b][1,4]benzoxaborinin-3-id-2-yl]-1,2,2-trimethyl-[1,3]oxazolo[5,4-c]pyridine;iridium (PubChem CID 166020390) has the molecular formula C29H26BIrN2O2- and a molecular weight of 637.57 g/mol. Its IUPAC name is 4-[10-(2,6-dimethylphenyl)-3H-benzo[b][1,4]benzoxaborinin-3-id-2-yl]-1,2,2-trimethyl-[1,3]oxazolo[5,4-c]pyridine;iridium.
| Compound Name | 4-[10-(2,6-dimethylphenyl)-3H-benzo[b][1,4]benzoxaborinin-3-id-2-yl]-1,2,2-trimethyl-[1,3]oxazolo[5,4-c]pyridine;iridium |
|---|---|
| PubChem CID | 166020390 |
| Molecular Formula | C29H26BIrN2O2- |
| Molecular Weight | 637.57 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | 4-[10-(2,6-dimethylphenyl)-3H-benzo[b][1,4]benzoxaborinin-3-id-2-yl]-1,2,2-trimethyl-[1,3]oxazolo[5,4-c]pyridine;iridium |
| SMILES | Cc1cccc(C)c1B1c2ccccc2Oc2c[c-]c(-c3nccc4c3OC(C)(C)N4C)cc21.[Ir] |
| InChI | InChI=1S/C29H26BN2O2.Ir/c1-18-9-8-10-19(2)26(18)30-21-11-6-7-12-24(21)33-25-14-13-20(17-22(25)30)27-28-23(15-16-31-27)32(5)29(3,4)34-28;/h6-12,14-17H,1-5H3;/q-1; |
| InChIKey | IVFUCZPKDKWOEW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|