C56H48BIrN3O2-2 — CID 176865524
CID 176865524 (PubChem CID 176865524) has the molecular formula C56H48BIrN3O2-2 and a molecular weight of 998.05 g/mol.
| Compound Name | CID 176865524 |
|---|---|
| PubChem CID | 176865524 |
| Molecular Formula | C56H48BIrN3O2-2 |
| Molecular Weight | 998.05 g/mol |
| Exact Mass | 998.35 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2[c-]cccc2)nc1.CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]cc3c(c2)B2c4ccccc4Oc4cccc(c42)O3)nc2ccc3ccccc3c21.[Ir] |
| InChI | InChI=1S/C41H32BN2O2.C15H16N.Ir/c1-24(2)28-13-9-14-29(25(3)4)39(28)44-40-30-12-6-5-11-26(30)19-21-33(40)43-41(44)27-20-22-35-32(23-27)42-31-15-7-8-16-34(31)45-36-17-10-18-37(46-35)38(36)42;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h5-19,21-25H,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | BVRARZCHDBVIER-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 998.05 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|