About 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol
5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol (PubChem CID 166020825) has the molecular formula C19H16ClFO4
and a molecular weight of 362.78 g/mol. Its IUPAC name is 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol.
Molecular Properties
| Compound Name | 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol |
| PubChem CID | 166020825 |
| Molecular Formula | C19H16ClFO4 |
| Molecular Weight | 362.78 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol |
| SMILES | CC1(c2ccc(Cl)cc2F)Oc2cccc(C3=CCC(O)OC3)c2O1 |
| InChI | InChI=1S/C19H16ClFO4/c1-19(14-7-6-12(20)9-15(14)21)24-16-4-2-3-13(18(16)25-19)11-5-8-17(22)23-10-11/h2-7,9,17,22H,8,10H2,1H3 |
| InChIKey | KDSQLQDCZBWLKT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol?
The IUPAC name of 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol (CID 166020825) is 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol.
What is the SMILES notation for 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol?
The canonical SMILES for 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol is CC1(c2ccc(Cl)cc2F)Oc2cccc(C3=CCC(O)OC3)c2O1.
What is the InChIKey of 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol?
The InChIKey is KDSQLQDCZBWLKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClFO4/c1-19(14-7-6-12(20)9-15(14)21)24-16-4-2-3-13(18(16)25-19)11-5-8-17(22)23-10-11/h2-7,9,17,22H,8,10H2,1H3.
What are the key properties of 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol?
5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol has a molecular weight of 362.78 g/mol, XLogP of 4.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-3,6-dihydro-2H-pyran-2-ol is sourced from PubChem (CID 166020825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).