C24H21BrCl2F2O4 — CID 167638492
4-bromo-2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxole;4-chloro-1-(1,1-dimethoxyethyl)-2-fluorobenzene (PubChem CID 167638492) has the molecular formula C24H21BrCl2F2O4 and a molecular weight of 562.23 g/mol. Its IUPAC name is 4-bromo-2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxole;4-chloro-1-(1,1-dimethoxyethyl)-2-fluorobenzene.
| Compound Name | 4-bromo-2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxole;4-chloro-1-(1,1-dimethoxyethyl)-2-fluorobenzene |
|---|---|
| PubChem CID | 167638492 |
| Molecular Formula | C24H21BrCl2F2O4 |
| Molecular Weight | 562.23 g/mol |
| Exact Mass | 560.00 |
| IUPAC Name | 4-bromo-2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxole;4-chloro-1-(1,1-dimethoxyethyl)-2-fluorobenzene |
| SMILES | CC1(c2ccc(Cl)cc2F)Oc2cccc(Br)c2O1.COC(C)(OC)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H9BrClFO2.C10H12ClFO2/c1-14(9-6-5-8(16)7-11(9)17)18-12-4-2-3-10(15)13(12)19-14;1-10(13-2,14-3)8-5-4-7(11)6-9(8)12/h2-7H,1H3;4-6H,1-3H3 |
| InChIKey | OVBWDQLJNWWYFW-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.23 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|