C15H9BrFNO2 — CID 155627039
4-bromo-2-(2-fluoro-4-isocyanophenyl)-2-methyl-1,3-benzodioxole (PubChem CID 155627039) has the molecular formula C15H9BrFNO2 and a molecular weight of 334.14 g/mol. Its IUPAC name is 4-bromo-2-(2-fluoro-4-isocyanophenyl)-2-methyl-1,3-benzodioxole.
| Compound Name | 4-bromo-2-(2-fluoro-4-isocyanophenyl)-2-methyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 155627039 |
| Molecular Formula | C15H9BrFNO2 |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 4-bromo-2-(2-fluoro-4-isocyanophenyl)-2-methyl-1,3-benzodioxole |
| SMILES | [C-]#[N+]c1ccc(C2(C)Oc3cccc(Br)c3O2)c(F)c1 |
| InChI | InChI=1S/C15H9BrFNO2/c1-15(10-7-6-9(18-2)8-12(10)17)19-13-5-3-4-11(16)14(13)20-15/h3-8H,1H3 |
| InChIKey | BQUFDNDVCDMXRI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|