C22H25ClFN3O6 — CID 175587803
[2-[[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]carbamic acid (PubChem CID 175587803) has the molecular formula C22H25ClFN3O6 and a molecular weight of 481.91 g/mol. Its IUPAC name is [2-[[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]carbamic acid.
| Compound Name | [2-[[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]carbamic acid |
|---|---|
| PubChem CID | 175587803 |
| Molecular Formula | C22H25ClFN3O6 |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | [2-[[2-(4-chloro-2-fluorophenyl)-2-methyl-1,3-benzodioxol-4-yl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]carbamic acid |
| SMILES | CC(C)(C)OC(=O)N(CCNNC(=O)O)c1cccc2c1OC(C)(c1ccc(Cl)cc1F)O2 |
| InChI | InChI=1S/C22H25ClFN3O6/c1-21(2,3)33-20(30)27(11-10-25-26-19(28)29)16-6-5-7-17-18(16)32-22(4,31-17)14-9-8-13(23)12-15(14)24/h5-9,12,25-26H,10-11H2,1-4H3,(H,28,29) |
| InChIKey | VLFQSRGGTRHIII-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|