C19H18ClNO3 — CID 166021153
2-[[(Z)-5-(4-chlorophenyl)-3-phenylpent-2-enoyl]amino]acetic acid (PubChem CID 166021153) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is 2-[[(Z)-5-(4-chlorophenyl)-3-phenylpent-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-5-(4-chlorophenyl)-3-phenylpent-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 166021153 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-[[(Z)-5-(4-chlorophenyl)-3-phenylpent-2-enoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)/C=C(/CCc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H18ClNO3/c20-17-10-7-14(8-11-17)6-9-16(15-4-2-1-3-5-15)12-18(22)21-13-19(23)24/h1-5,7-8,10-12H,6,9,13H2,(H,21,22)(H,23,24)/b16-12- |
| InChIKey | PXFOWLCRHLXCGF-VBKFSLOCSA-N |
| XLogP | 3.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|