C10H15NO3 — CID 166022780
methyl (2S)-2-[(2S)-2-hydroxybut-3-yn-2-yl]pyrrolidine-1-carboxylate (PubChem CID 166022780) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is methyl (2S)-2-[(2S)-2-hydroxybut-3-yn-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | methyl (2S)-2-[(2S)-2-hydroxybut-3-yn-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166022780 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | methyl (2S)-2-[(2S)-2-hydroxybut-3-yn-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C#C[C@](C)(O)[C@@H]1CCCN1C(=O)OC |
| InChI | InChI=1S/C10H15NO3/c1-4-10(2,13)8-6-5-7-11(8)9(12)14-3/h1,8,13H,5-7H2,2-3H3/t8-,10-/m0/s1 |
| InChIKey | KEEXUUGILKNNNG-WPRPVWTQSA-N |
| XLogP | 0.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|