C25H30N7O9P — CID 166023175
[(2S)-1-amino-1-oxopropan-2-yl] (2S)-2-[[1-[(2S,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166023175) has the molecular formula C25H30N7O9P and a molecular weight of 603.53 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] (2S)-2-[[1-[(2S,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] (2S)-2-[[1-[(2S,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166023175 |
| Molecular Formula | C25H30N7O9P |
| Molecular Weight | 603.53 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] (2S)-2-[[1-[(2S,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxyoxolan-2-yl]ethoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(OP(=O)(N[C@@H](C)C(=O)O[C@@H](C)C(N)=O)Oc1ccccc1)[C@@]1(C#N)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H30N7O9P/c1-13(24(36)38-14(2)23(28)35)31-42(37,41-16-7-5-4-6-8-16)40-15(3)25(11-26)21(34)19(33)20(39-25)17-9-10-18-22(27)29-12-30-32(17)18/h4-10,12-15,19-21,33-34H,1-3H3,(H2,28,35)(H,31,37)(H2,27,29,30)/t13-,14-,15?,19-,20-,21-,25+,42?/m0/s1 |
| InChIKey | CDEKEHLDILUFRG-YSAINOCLSA-N |
| XLogP | 0.35 |
| TPSA | 246.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.53 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|