C13H13BrNO4S+ — CID 166023511
(5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3,3-dimethyl-1,3-thiazolidin-3-ium-2,4-dione (PubChem CID 166023511) has the molecular formula C13H13BrNO4S+ and a molecular weight of 359.22 g/mol. Its IUPAC name is (5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3,3-dimethyl-1,3-thiazolidin-3-ium-2,4-dione.
| Compound Name | (5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3,3-dimethyl-1,3-thiazolidin-3-ium-2,4-dione |
|---|---|
| PubChem CID | 166023511 |
| Molecular Formula | C13H13BrNO4S+ |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | (5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3,3-dimethyl-1,3-thiazolidin-3-ium-2,4-dione |
| SMILES | COc1cc(/C=C2\SC(=O)[N+](C)(C)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C13H12BrNO4S/c1-15(2)12(17)11(20-13(15)18)5-7-4-10(19-3)9(16)6-8(7)14/h4-6H,1-3H3/p+1 |
| InChIKey | ILGPABGMIMSUDQ-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|