C16H34N2 — CID 166024715
1,2,3-tritert-butylpiperazine (PubChem CID 166024715) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 1,2,3-tritert-butylpiperazine.
| Compound Name | 1,2,3-tritert-butylpiperazine |
|---|---|
| PubChem CID | 166024715 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 1,2,3-tritert-butylpiperazine |
| SMILES | CC(C)(C)C1NCCN(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C16H34N2/c1-14(2,3)12-13(15(4,5)6)18(11-10-17-12)16(7,8)9/h12-13,17H,10-11H2,1-9H3 |
| InChIKey | QHCUBYLPJQHBCM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |