C13H26N2 — CID 176728526
2,3-ditert-butyl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 176728526) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 2,3-ditert-butyl-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 2,3-ditert-butyl-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 176728526 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2,3-ditert-butyl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | CC(C)(C)C1C2CC(CN1C(C)(C)C)N2 |
| InChI | InChI=1S/C13H26N2/c1-12(2,3)11-10-7-9(14-10)8-15(11)13(4,5)6/h9-11,14H,7-8H2,1-6H3 |
| InChIKey | LSEKNJQBIQEJHB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |