C19H40N4 — CID 129303697
4,6,11-tritert-butyl-1,4,6,11-tetrazabicyclo[3.3.3]undecane (PubChem CID 129303697) has the molecular formula C19H40N4 and a molecular weight of 324.56 g/mol. Its IUPAC name is 4,6,11-tritert-butyl-1,4,6,11-tetrazabicyclo[3.3.3]undecane.
| Compound Name | 4,6,11-tritert-butyl-1,4,6,11-tetrazabicyclo[3.3.3]undecane |
|---|---|
| PubChem CID | 129303697 |
| Molecular Formula | C19H40N4 |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.33 |
| IUPAC Name | 4,6,11-tritert-butyl-1,4,6,11-tetrazabicyclo[3.3.3]undecane |
| SMILES | CC(C)(C)N1CCN2CCN(C(C)(C)C)C1N(C(C)(C)C)CC2 |
| InChI | InChI=1S/C19H40N4/c1-17(2,3)21-13-10-20-11-14-22(18(4,5)6)16(21)23(15-12-20)19(7,8)9/h16H,10-15H2,1-9H3 |
| InChIKey | ODLSUJPPHKWPFE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |