C10H19F3N2 — CID 168820917
(2S)-1-tert-butyl-2-methyl-4-(trifluoromethyl)piperazine (PubChem CID 168820917) has the molecular formula C10H19F3N2 and a molecular weight of 224.27 g/mol. Its IUPAC name is (2S)-1-tert-butyl-2-methyl-4-(trifluoromethyl)piperazine.
| Compound Name | (2S)-1-tert-butyl-2-methyl-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 168820917 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (2S)-1-tert-butyl-2-methyl-4-(trifluoromethyl)piperazine |
| SMILES | C[C@H]1CN(C(F)(F)F)CCN1C(C)(C)C |
| InChI | InChI=1S/C10H19F3N2/c1-8-7-14(10(11,12)13)5-6-15(8)9(2,3)4/h8H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | IXFCUCCJBVXCPC-QMMMGPOBSA-N |
| XLogP | 2.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|