C25H23N5O3S — CID 16602640
ethyl 2-[2-[[(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 16602640) has the molecular formula C25H23N5O3S and a molecular weight of 473.56 g/mol. Its IUPAC name is ethyl 2-[2-[[(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 16602640 |
| Molecular Formula | C25H23N5O3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | ethyl 2-[2-[[(E)-3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enoyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2cccnc2)n1 |
| InChI | InChI=1S/C25H23N5O3S/c1-2-33-23(32)13-21-17-34-25(27-21)28-22(31)11-10-20-16-30(15-18-7-4-3-5-8-18)29-24(20)19-9-6-12-26-14-19/h3-12,14,16-17H,2,13,15H2,1H3,(H,27,28,31)/b11-10+ |
| InChIKey | KGGDKEIHYJEEPK-ZHACJKMWSA-N |
| XLogP | 4.21 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|