C28H31F2N5O3 — CID 166027401
2-[6-(difluoromethoxy)-2-pyridinyl]-N-[(1R,2R,4S)-7-[(4-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptan-2-yl]-4,5,6,7-tetrahydroindazole-5-carboxamide (PubChem CID 166027401) has the molecular formula C28H31F2N5O3 and a molecular weight of 523.58 g/mol. Its IUPAC name is 2-[6-(difluoromethoxy)-2-pyridinyl]-N-[(1R,2R,4S)-7-[(4-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptan-2-yl]-4,5,6,7-tetrahydroindazole-5-carboxamide.
| Compound Name | 2-[6-(difluoromethoxy)-2-pyridinyl]-N-[(1R,2R,4S)-7-[(4-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptan-2-yl]-4,5,6,7-tetrahydroindazole-5-carboxamide |
|---|---|
| PubChem CID | 166027401 |
| Molecular Formula | C28H31F2N5O3 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 2-[6-(difluoromethoxy)-2-pyridinyl]-N-[(1R,2R,4S)-7-[(4-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptan-2-yl]-4,5,6,7-tetrahydroindazole-5-carboxamide |
| SMILES | COc1ccc(CN2[C@H]3CC[C@@H]2[C@H](NC(=O)C2CCc4nn(-c5cccc(OC(F)F)n5)cc4C2)C3)cc1 |
| InChI | InChI=1S/C28H31F2N5O3/c1-37-21-9-5-17(6-10-21)15-34-20-8-12-24(34)23(14-20)31-27(36)18-7-11-22-19(13-18)16-35(33-22)25-3-2-4-26(32-25)38-28(29)30/h2-6,9-10,16,18,20,23-24,28H,7-8,11-15H2,1H3,(H,31,36)/t18?,20-,23+,24+/m0/s1 |
| InChIKey | HCIVBFUDNBILCQ-MHRPHXBCSA-N |
| XLogP | 3.90 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |