C30H35N5O2 — CID 166027449
1-(6-cyclopropyl-2-pyridinyl)-N-[(1R,2R,4S)-7-[(4-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptan-2-yl]-4,5,6,7-tetrahydroindazole-5-carboxamide (PubChem CID 166027449) has the molecular formula C30H35N5O2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 1-(6-cyclopropyl-2-pyridinyl)-N-[(1R,2R,4S)-7-[(4-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptan-2-yl]-4,5,6,7-tetrahydroindazole-5-carboxamide.
| Compound Name | 1-(6-cyclopropyl-2-pyridinyl)-N-[(1R,2R,4S)-7-[(4-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptan-2-yl]-4,5,6,7-tetrahydroindazole-5-carboxamide |
|---|---|
| PubChem CID | 166027449 |
| Molecular Formula | C30H35N5O2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 1-(6-cyclopropyl-2-pyridinyl)-N-[(1R,2R,4S)-7-[(4-methoxyphenyl)methyl]-7-azabicyclo[2.2.1]heptan-2-yl]-4,5,6,7-tetrahydroindazole-5-carboxamide |
| SMILES | COc1ccc(CN2[C@H]3CC[C@@H]2[C@H](NC(=O)C2CCc4c(cnn4-c4cccc(C5CC5)n4)C2)C3)cc1 |
| InChI | InChI=1S/C30H35N5O2/c1-37-24-11-5-19(6-12-24)18-34-23-10-14-28(34)26(16-23)33-30(36)21-9-13-27-22(15-21)17-31-35(27)29-4-2-3-25(32-29)20-7-8-20/h2-6,11-12,17,20-21,23,26,28H,7-10,13-16,18H2,1H3,(H,33,36)/t21?,23-,26+,28+/m0/s1 |
| InChIKey | VESIICSIMGJUSL-JHRUBJCDSA-N |
| XLogP | 4.18 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |