C50H34N4O — CID 166031204
4-[4-(9,9-dimethylfluoren-2-yl)-6-(9,9-diphenylxanthen-3-yl)-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 166031204) has the molecular formula C50H34N4O and a molecular weight of 706.85 g/mol. Its IUPAC name is 4-[4-(9,9-dimethylfluoren-2-yl)-6-(9,9-diphenylxanthen-3-yl)-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 4-[4-(9,9-dimethylfluoren-2-yl)-6-(9,9-diphenylxanthen-3-yl)-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 166031204 |
| Molecular Formula | C50H34N4O |
| Molecular Weight | 706.85 g/mol |
| Exact Mass | 706.27 |
| IUPAC Name | 4-[4-(9,9-dimethylfluoren-2-yl)-6-(9,9-diphenylxanthen-3-yl)-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4ccc(C#N)cc4)nc(-c4ccc5c(c4)Oc4ccccc4C5(c4ccccc4)c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C50H34N4O/c1-49(2)40-18-10-9-17-38(40)39-27-25-34(29-43(39)49)47-52-46(33-23-21-32(31-51)22-24-33)53-48(54-47)35-26-28-42-45(30-35)55-44-20-12-11-19-41(44)50(42,36-13-5-3-6-14-36)37-15-7-4-8-16-37/h3-30H,1-2H3 |
| InChIKey | VZIYNIMZYXLKOV-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.85 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |