C24H24N4O2S — CID 166046733
N-methyl-6-[5-(3-phenylbutylcarbamoyl)thiophen-2-yl]-1H-indazole-3-carboxamide (PubChem CID 166046733) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-methyl-6-[5-(3-phenylbutylcarbamoyl)thiophen-2-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-methyl-6-[5-(3-phenylbutylcarbamoyl)thiophen-2-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 166046733 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-methyl-6-[5-(3-phenylbutylcarbamoyl)thiophen-2-yl]-1H-indazole-3-carboxamide |
| SMILES | CNC(=O)c1n[nH]c2cc(-c3ccc(C(=O)NCCC(C)c4ccccc4)s3)ccc12 |
| InChI | InChI=1S/C24H24N4O2S/c1-15(16-6-4-3-5-7-16)12-13-26-23(29)21-11-10-20(31-21)17-8-9-18-19(14-17)27-28-22(18)24(30)25-2/h3-11,14-15H,12-13H2,1-2H3,(H,25,30)(H,26,29)(H,27,28) |
| InChIKey | YWZFHOTUBSNTST-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |