C18H25FN4O — CID 166046827
2-[(1R)-1-(1,4-diazepan-1-yl)butyl]-6-fluoro-3-methylquinazolin-4-one (PubChem CID 166046827) has the molecular formula C18H25FN4O and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[(1R)-1-(1,4-diazepan-1-yl)butyl]-6-fluoro-3-methylquinazolin-4-one.
| Compound Name | 2-[(1R)-1-(1,4-diazepan-1-yl)butyl]-6-fluoro-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 166046827 |
| Molecular Formula | C18H25FN4O |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[(1R)-1-(1,4-diazepan-1-yl)butyl]-6-fluoro-3-methylquinazolin-4-one |
| SMILES | CCC[C@H](c1nc2ccc(F)cc2c(=O)n1C)N1CCCNCC1 |
| InChI | InChI=1S/C18H25FN4O/c1-3-5-16(23-10-4-8-20-9-11-23)17-21-15-7-6-13(19)12-14(15)18(24)22(17)2/h6-7,12,16,20H,3-5,8-11H2,1-2H3/t16-/m1/s1 |
| InChIKey | IKJLAFOKLRAPBX-MRXNPFEDSA-N |
| XLogP | 2.21 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |