C27H23FNOS+ — CID 166051332
2-[7-fluoro-3-methyl-6-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 166051332) has the molecular formula C27H23FNOS+ and a molecular weight of 428.55 g/mol. Its IUPAC name is 2-[7-fluoro-3-methyl-6-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[7-fluoro-3-methyl-6-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166051332 |
| Molecular Formula | C27H23FNOS+ |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-[7-fluoro-3-methyl-6-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4cc5c(s4)CCCC5)c(F)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C27H23FNOS/c1-16-10-11-18-19-12-13-20(28)25(23-15-17-7-3-4-9-22(17)31-23)27(19)30-26(18)24(16)21-8-5-6-14-29(21)2/h5-6,8,10-15H,3-4,7,9H2,1-2H3/q+1 |
| InChIKey | SYNXXJSRNPFXME-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|