C20H20Cl2FN5O2 — CID 166052190
tert-butyl 3-(3,6-dichloro-5-fluoro-4-isocyano-2,7-naphthyridin-1-yl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 166052190) has the molecular formula C20H20Cl2FN5O2 and a molecular weight of 452.32 g/mol. Its IUPAC name is tert-butyl 3-(3,6-dichloro-5-fluoro-4-isocyano-2,7-naphthyridin-1-yl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-(3,6-dichloro-5-fluoro-4-isocyano-2,7-naphthyridin-1-yl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 166052190 |
| Molecular Formula | C20H20Cl2FN5O2 |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | tert-butyl 3-(3,6-dichloro-5-fluoro-4-isocyano-2,7-naphthyridin-1-yl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | [C-]#[N+]c1c(Cl)nc(N2CC3CCC(C2)N3C(=O)OC(C)(C)C)c2cnc(Cl)c(F)c12 |
| InChI | InChI=1S/C20H20Cl2FN5O2/c1-20(2,3)30-19(29)28-10-5-6-11(28)9-27(8-10)18-12-7-25-16(21)14(23)13(12)15(24-4)17(22)26-18/h7,10-11H,5-6,8-9H2,1-3H3 |
| InChIKey | VFHFOHCJHSFOLE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 62.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|