C29H32N+ — CID 166053225
3,12,12,15,19,20-hexamethyl-8-propan-2-yl-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 166053225) has the molecular formula C29H32N+ and a molecular weight of 394.58 g/mol. Its IUPAC name is 3,12,12,15,19,20-hexamethyl-8-propan-2-yl-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 3,12,12,15,19,20-hexamethyl-8-propan-2-yl-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166053225 |
| Molecular Formula | C29H32N+ |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 3,12,12,15,19,20-hexamethyl-8-propan-2-yl-3-azoniapentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | Cc1cc2c3c(c(C)c(C)cc3c1)-c1c(c3cc(C(C)C)ccc3c[n+]1C)C2(C)C |
| InChI | InChI=1S/C29H32N/c1-16(2)20-9-10-21-15-30(8)28-25-19(5)18(4)13-22-11-17(3)12-24(26(22)25)29(6,7)27(28)23(21)14-20/h9-16H,1-8H3/q+1 |
| InChIKey | JERBMBYUHCYJRA-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|