C25H27N2+ — CID 166053973
3,7,11,11,14,18,19-heptamethyl-7-aza-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene (PubChem CID 166053973) has the molecular formula C25H27N2+ and a molecular weight of 355.51 g/mol. Its IUPAC name is 3,7,11,11,14,18,19-heptamethyl-7-aza-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene.
| Compound Name | 3,7,11,11,14,18,19-heptamethyl-7-aza-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 166053973 |
| Molecular Formula | C25H27N2+ |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | 3,7,11,11,14,18,19-heptamethyl-7-aza-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene |
| SMILES | Cc1cc2c3c(c(C)c(C)cc3c1)-c1c(cc3c(ccn3C)[n+]1C)C2(C)C |
| InChI | InChI=1S/C25H27N2/c1-14-10-17-12-15(2)16(3)22-23(17)18(11-14)25(4,5)19-13-21-20(8-9-26(21)6)27(7)24(19)22/h8-13H,1-7H3/q+1 |
| InChIKey | AOTKRHQDTYZPED-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|