C20H16FN2O+ — CID 166053783
9-fluoro-3,5,19-trimethyl-11-oxa-3-aza-5-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaene (PubChem CID 166053783) has the molecular formula C20H16FN2O+ and a molecular weight of 319.36 g/mol. Its IUPAC name is 9-fluoro-3,5,19-trimethyl-11-oxa-3-aza-5-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaene.
| Compound Name | 9-fluoro-3,5,19-trimethyl-11-oxa-3-aza-5-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 166053783 |
| Molecular Formula | C20H16FN2O+ |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 9-fluoro-3,5,19-trimethyl-11-oxa-3-aza-5-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaene |
| SMILES | Cc1ccc2cccc3oc4c(F)c5cc[n+](C)c5n(C)c4c1c23 |
| InChI | InChI=1S/C20H16FN2O/c1-11-7-8-12-5-4-6-14-16(12)15(11)18-19(24-14)17(21)13-9-10-22(2)20(13)23(18)3/h4-10H,1-3H3/q+1 |
| InChIKey | UCRYQTLGBQSYBT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|