C26H26N3O+ — CID 166053642
9-(2-isocyano-2-methylpropyl)-3,7,18,19-tetramethyl-11-oxa-3-aza-7-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaene (PubChem CID 166053642) has the molecular formula C26H26N3O+ and a molecular weight of 396.51 g/mol. Its IUPAC name is 9-(2-isocyano-2-methylpropyl)-3,7,18,19-tetramethyl-11-oxa-3-aza-7-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaene.
| Compound Name | 9-(2-isocyano-2-methylpropyl)-3,7,18,19-tetramethyl-11-oxa-3-aza-7-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 166053642 |
| Molecular Formula | C26H26N3O+ |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 9-(2-isocyano-2-methylpropyl)-3,7,18,19-tetramethyl-11-oxa-3-aza-7-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),4,6,8,12,14,16(20),17-nonaene |
| SMILES | [C-]#[N+]C(C)(C)Cc1c2oc3cccc4cc(C)c(C)c(c43)c2n(C)c2cc[n+](C)c12 |
| InChI | InChI=1S/C26H26N3O/c1-15-13-17-9-8-10-20-22(17)21(16(15)2)24-25(30-20)18(14-26(3,4)27-5)23-19(29(24)7)11-12-28(23)6/h8-13H,14H2,1-4,6-7H3/q+1 |
| InChIKey | MLYPKFRWVTXPLP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 26.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|