C29H26N3+ — CID 170685258
5-(2-isocyano-2-methylpropyl)-11,14,15-trimethyl-1-aza-11-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene (PubChem CID 170685258) has the molecular formula C29H26N3+ and a molecular weight of 416.55 g/mol. Its IUPAC name is 5-(2-isocyano-2-methylpropyl)-11,14,15-trimethyl-1-aza-11-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene.
| Compound Name | 5-(2-isocyano-2-methylpropyl)-11,14,15-trimethyl-1-aza-11-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene |
|---|---|
| PubChem CID | 170685258 |
| Molecular Formula | C29H26N3+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 5-(2-isocyano-2-methylpropyl)-11,14,15-trimethyl-1-aza-11-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene |
| SMILES | [C-]#[N+]C(C)(C)Cc1ccc2c(c1)c1cc[n+](C)c3c4c(C)c(C)cc5cccc(c54)n2c13 |
| InChI | InChI=1S/C29H26N3/c1-17-14-20-8-7-9-24-26(20)25(18(17)2)28-27-21(12-13-31(28)6)22-15-19(16-29(3,4)30-5)10-11-23(22)32(24)27/h7-15H,16H2,1-4,6H3/q+1 |
| InChIKey | SINKZBRONXJTAO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 12.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|