C24H17N4+ — CID 170684884
4-isocyano-11,14,15-trimethyl-1,9-diaza-11-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene (PubChem CID 170684884) has the molecular formula C24H17N4+ and a molecular weight of 361.43 g/mol. Its IUPAC name is 4-isocyano-11,14,15-trimethyl-1,9-diaza-11-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene.
| Compound Name | 4-isocyano-11,14,15-trimethyl-1,9-diaza-11-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene |
|---|---|
| PubChem CID | 170684884 |
| Molecular Formula | C24H17N4+ |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 4-isocyano-11,14,15-trimethyl-1,9-diaza-11-azoniahexacyclo[10.9.1.113,17.02,7.08,22.021,23]tricosa-2(7),3,5,8(22),9,11,13,15,17(23),18,20-undecaene |
| SMILES | [C-]#[N+]c1ccc2c3nc[n+](C)c4c5c(C)c(C)cc6cccc(c65)n(c2c1)c34 |
| InChI | InChI=1S/C24H17N4/c1-13-10-15-6-5-7-18-21(15)20(14(13)2)23-24-22(26-12-27(23)4)17-9-8-16(25-3)11-19(17)28(18)24/h5-12H,1-2,4H3/q+1 |
| InChIKey | JGDSUWDKBYDXTE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 25.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|