C32H40O13 — CID 166055653
3-O-[2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] 1-O-[2-[4-[2,2-bis(hydroxymethyl)butoxycarbonyl]benzoyl]oxyethyl] benzene-1,3-dicarboxylate (PubChem CID 166055653) has the molecular formula C32H40O13 and a molecular weight of 632.66 g/mol. Its IUPAC name is 3-O-[2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] 1-O-[2-[4-[2,2-bis(hydroxymethyl)butoxycarbonyl]benzoyl]oxyethyl] benzene-1,3-dicarboxylate.
| Compound Name | 3-O-[2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] 1-O-[2-[4-[2,2-bis(hydroxymethyl)butoxycarbonyl]benzoyl]oxyethyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 166055653 |
| Molecular Formula | C32H40O13 |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | 3-O-[2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] 1-O-[2-[4-[2,2-bis(hydroxymethyl)butoxycarbonyl]benzoyl]oxyethyl] benzene-1,3-dicarboxylate |
| SMILES | CCC(CO)(CO)COC(=O)c1ccc(C(=O)OCCOC(=O)c2cccc(C(=O)OCC(CC)(CO)COC(C)=O)c2)cc1 |
| InChI | InChI=1S/C32H40O13/c1-4-31(16-33,17-34)19-44-28(38)24-11-9-23(10-12-24)27(37)41-13-14-42-29(39)25-7-6-8-26(15-25)30(40)45-21-32(5-2,18-35)20-43-22(3)36/h6-12,15,33-35H,4-5,13-14,16-21H2,1-3H3 |
| InChIKey | CMCDGUYKHSMAKN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|