C20H28BrN3O — CID 166061905
4-bromo-3-methyl-1-N-[2-[methyl(3-phenylmethoxypropyl)amino]ethyl]benzene-1,2-diamine (PubChem CID 166061905) has the molecular formula C20H28BrN3O and a molecular weight of 406.37 g/mol. Its IUPAC name is 4-bromo-3-methyl-1-N-[2-[methyl(3-phenylmethoxypropyl)amino]ethyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-3-methyl-1-N-[2-[methyl(3-phenylmethoxypropyl)amino]ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 166061905 |
| Molecular Formula | C20H28BrN3O |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 4-bromo-3-methyl-1-N-[2-[methyl(3-phenylmethoxypropyl)amino]ethyl]benzene-1,2-diamine |
| SMILES | Cc1c(Br)ccc(NCCN(C)CCCOCc2ccccc2)c1N |
| InChI | InChI=1S/C20H28BrN3O/c1-16-18(21)9-10-19(20(16)22)23-11-13-24(2)12-6-14-25-15-17-7-4-3-5-8-17/h3-5,7-10,23H,6,11-15,22H2,1-2H3 |
| InChIKey | LKCJGHZEWQSSFB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|