C23H15F4N3O — CID 166062953
N-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]prop-2-enamide (PubChem CID 166062953) has the molecular formula C23H15F4N3O and a molecular weight of 425.39 g/mol. Its IUPAC name is N-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]prop-2-enamide.
| Compound Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166062953 |
| Molecular Formula | C23H15F4N3O |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(-c2cnc3[nH]ccc3c2)c1)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C23H15F4N3O/c24-19-6-5-18(23(25,26)27)12-20(19)30-21(31)7-4-14-2-1-3-15(10-14)17-11-16-8-9-28-22(16)29-13-17/h1-13H,(H,28,29)(H,30,31) |
| InChIKey | JVYUVPUXBXPLHH-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|