About 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide
3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide (PubChem CID 166063251) has the molecular formula C15H15F2N3O2
and a molecular weight of 307.30 g/mol. Its IUPAC name is 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide.
Molecular Properties
| Compound Name | 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide |
| PubChem CID | 166063251 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)N2CC(F)(F)C[C@H]2C#N)cc1 |
| InChI | InChI=1S/C15H15F2N3O2/c1-10-2-4-11(5-3-10)19-13(21)6-14(22)20-9-15(16,17)7-12(20)8-18/h2-5,12H,6-7,9H2,1H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | UNMLESHQEAOGLH-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide?
The IUPAC name of 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide (CID 166063251) is 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide.
What is the SMILES notation for 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide?
The canonical SMILES for 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide is Cc1ccc(NC(=O)CC(=O)N2CC(F)(F)C[C@H]2C#N)cc1.
What is the InChIKey of 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide?
The InChIKey is UNMLESHQEAOGLH-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H15F2N3O2/c1-10-2-4-11(5-3-10)19-13(21)6-14(22)20-9-15(16,17)7-12(20)8-18/h2-5,12H,6-7,9H2,1H3,(H,19,21)/t12-/m0/s1.
What are the key properties of 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide?
3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide has a molecular weight of 307.30 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide is sourced from PubChem (CID 166063251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).