C15H15F2N3O2 — CID 166063251
3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide (PubChem CID 166063251) has the molecular formula C15H15F2N3O2 and a molecular weight of 307.30 g/mol. Its IUPAC name is 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide.
| Compound Name | 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 166063251 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-[(2S)-2-cyano-4,4-difluoropyrrolidin-1-yl]-N-(4-methylphenyl)-3-oxopropanamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)N2CC(F)(F)C[C@H]2C#N)cc1 |
| InChI | InChI=1S/C15H15F2N3O2/c1-10-2-4-11(5-3-10)19-13(21)6-14(22)20-9-15(16,17)7-12(20)8-18/h2-5,12H,6-7,9H2,1H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | UNMLESHQEAOGLH-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|