C16H21N3O3 — CID 95188772
3-[(2R)-2-methyl-5-oxo-1,4-diazepan-1-yl]-N-(4-methylphenyl)-3-oxopropanamide (PubChem CID 95188772) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-[(2R)-2-methyl-5-oxo-1,4-diazepan-1-yl]-N-(4-methylphenyl)-3-oxopropanamide.
| Compound Name | 3-[(2R)-2-methyl-5-oxo-1,4-diazepan-1-yl]-N-(4-methylphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 95188772 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-[(2R)-2-methyl-5-oxo-1,4-diazepan-1-yl]-N-(4-methylphenyl)-3-oxopropanamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)N2CCC(=O)NC[C@H]2C)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-11-3-5-13(6-4-11)18-15(21)9-16(22)19-8-7-14(20)17-10-12(19)2/h3-6,12H,7-10H2,1-2H3,(H,17,20)(H,18,21)/t12-/m1/s1 |
| InChIKey | MFOIQVLVSPFJQX-GFCCVEGCSA-N |
| XLogP | 1.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|