C16H10F3N3O4 — CID 166065924
6,7-difluoro-5-[(4-fluoro-2-methoxy-5-nitrophenoxy)methyl]quinoxaline (PubChem CID 166065924) has the molecular formula C16H10F3N3O4 and a molecular weight of 365.27 g/mol. Its IUPAC name is 6,7-difluoro-5-[(4-fluoro-2-methoxy-5-nitrophenoxy)methyl]quinoxaline.
| Compound Name | 6,7-difluoro-5-[(4-fluoro-2-methoxy-5-nitrophenoxy)methyl]quinoxaline |
|---|---|
| PubChem CID | 166065924 |
| Molecular Formula | C16H10F3N3O4 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 6,7-difluoro-5-[(4-fluoro-2-methoxy-5-nitrophenoxy)methyl]quinoxaline |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1OCc1c(F)c(F)cc2nccnc12 |
| InChI | InChI=1S/C16H10F3N3O4/c1-25-13-5-9(17)12(22(23)24)6-14(13)26-7-8-15(19)10(18)4-11-16(8)21-3-2-20-11/h2-6H,7H2,1H3 |
| InChIKey | IKVHFUGDYJEHEX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|