C16H13ClFNO5 — CID 166065842
4-chloro-7-[(4-fluoro-2-methoxy-5-nitrophenoxy)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 166065842) has the molecular formula C16H13ClFNO5 and a molecular weight of 353.73 g/mol. Its IUPAC name is 4-chloro-7-[(4-fluoro-2-methoxy-5-nitrophenoxy)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 4-chloro-7-[(4-fluoro-2-methoxy-5-nitrophenoxy)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 166065842 |
| Molecular Formula | C16H13ClFNO5 |
| Molecular Weight | 353.73 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-chloro-7-[(4-fluoro-2-methoxy-5-nitrophenoxy)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1OCc1ccc(Cl)c2c1OCC2 |
| InChI | InChI=1S/C16H13ClFNO5/c1-22-14-6-12(18)13(19(20)21)7-15(14)24-8-9-2-3-11(17)10-4-5-23-16(9)10/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | GADVJFMXXAULGZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.73 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|