C35H49N3O6S — CID 166066248
tert-butyl 4-[7-methoxy-2-methyl-4-[2,4,6-tri(propan-2-yl)phenyl]sulfonyloxyquinazolin-6-yl]piperidine-1-carboxylate (PubChem CID 166066248) has the molecular formula C35H49N3O6S and a molecular weight of 639.86 g/mol. Its IUPAC name is tert-butyl 4-[7-methoxy-2-methyl-4-[2,4,6-tri(propan-2-yl)phenyl]sulfonyloxyquinazolin-6-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[7-methoxy-2-methyl-4-[2,4,6-tri(propan-2-yl)phenyl]sulfonyloxyquinazolin-6-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166066248 |
| Molecular Formula | C35H49N3O6S |
| Molecular Weight | 639.86 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | tert-butyl 4-[7-methoxy-2-methyl-4-[2,4,6-tri(propan-2-yl)phenyl]sulfonyloxyquinazolin-6-yl]piperidine-1-carboxylate |
| SMILES | COc1cc2nc(C)nc(OS(=O)(=O)c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2cc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C35H49N3O6S/c1-20(2)25-16-26(21(3)4)32(27(17-25)22(5)6)45(40,41)44-33-29-18-28(31(42-11)19-30(29)36-23(7)37-33)24-12-14-38(15-13-24)34(39)43-35(8,9)10/h16-22,24H,12-15H2,1-11H3 |
| InChIKey | VGYCMWHZOPDWBX-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.86 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|