C26H28N4O8S — CID 166068043
tert-butyl N-[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2,5-dinitrothiophen-3-yl]phenyl]carbamate (PubChem CID 166068043) has the molecular formula C26H28N4O8S and a molecular weight of 556.60 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2,5-dinitrothiophen-3-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2,5-dinitrothiophen-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 166068043 |
| Molecular Formula | C26H28N4O8S |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | tert-butyl N-[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-2,5-dinitrothiophen-3-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2c([N+](=O)[O-])sc([N+](=O)[O-])c2-c2ccc(NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H28N4O8S/c1-25(2,3)37-23(31)27-17-11-7-15(8-12-17)19-20(22(30(35)36)39-21(19)29(33)34)16-9-13-18(14-10-16)28-24(32)38-26(4,5)6/h7-14H,1-6H3,(H,27,31)(H,28,32) |
| InChIKey | BHFORCXECWQKRY-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|