C12H20BrN3O3 — CID 166068597
tert-butyl 2-[2-[4-(2-bromoethyl)triazol-1-yl]ethoxy]acetate (PubChem CID 166068597) has the molecular formula C12H20BrN3O3 and a molecular weight of 334.21 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-(2-bromoethyl)triazol-1-yl]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[4-(2-bromoethyl)triazol-1-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 166068597 |
| Molecular Formula | C12H20BrN3O3 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | tert-butyl 2-[2-[4-(2-bromoethyl)triazol-1-yl]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCn1cc(CCBr)nn1 |
| InChI | InChI=1S/C12H20BrN3O3/c1-12(2,3)19-11(17)9-18-7-6-16-8-10(4-5-13)14-15-16/h8H,4-7,9H2,1-3H3 |
| InChIKey | NEOJSFVVGQZTAI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|