C18H17FN4O4 — CID 166070042
ethyl 6-(4-cyano-2-fluorophenyl)-5-nitro-4-(propan-2-ylamino)pyridine-3-carboxylate (PubChem CID 166070042) has the molecular formula C18H17FN4O4 and a molecular weight of 372.36 g/mol. Its IUPAC name is ethyl 6-(4-cyano-2-fluorophenyl)-5-nitro-4-(propan-2-ylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(4-cyano-2-fluorophenyl)-5-nitro-4-(propan-2-ylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 166070042 |
| Molecular Formula | C18H17FN4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | ethyl 6-(4-cyano-2-fluorophenyl)-5-nitro-4-(propan-2-ylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccc(C#N)cc2F)c([N+](=O)[O-])c1NC(C)C |
| InChI | InChI=1S/C18H17FN4O4/c1-4-27-18(24)13-9-21-15(12-6-5-11(8-20)7-14(12)19)17(23(25)26)16(13)22-10(2)3/h5-7,9-10H,4H2,1-3H3,(H,21,22) |
| InChIKey | VNSUEMBWROBYKA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|