C10H16FN3 — CID 166076598
ethane;7-fluoro-2-methyl-1,7a-dihydroindazol-4-amine (PubChem CID 166076598) has the molecular formula C10H16FN3 and a molecular weight of 197.26 g/mol. Its IUPAC name is ethane;7-fluoro-2-methyl-1,7a-dihydroindazol-4-amine.
| Compound Name | ethane;7-fluoro-2-methyl-1,7a-dihydroindazol-4-amine |
|---|---|
| PubChem CID | 166076598 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | ethane;7-fluoro-2-methyl-1,7a-dihydroindazol-4-amine |
| SMILES | CC.CN1C=C2C(N)=CC=C(F)C2N1 |
| InChI | InChI=1S/C8H10FN3.C2H6/c1-12-4-5-7(10)3-2-6(9)8(5)11-12;1-2/h2-4,8,11H,10H2,1H3;1-2H3 |
| InChIKey | LJKREJYPIMISDU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |