C58H116N4O6S2 — CID 166078411
S-[2-[4-[2-[5-[bis(2-hydroxydecyl)amino]pentanoylsulfanyl]ethyl]piperazin-1-yl]ethyl] 5-[bis(2-hydroxydecyl)amino]pentanethioate (PubChem CID 166078411) has the molecular formula C58H116N4O6S2 and a molecular weight of 1029.72 g/mol. Its IUPAC name is S-[2-[4-[2-[5-[bis(2-hydroxydecyl)amino]pentanoylsulfanyl]ethyl]piperazin-1-yl]ethyl] 5-[bis(2-hydroxydecyl)amino]pentanethioate.
| Compound Name | S-[2-[4-[2-[5-[bis(2-hydroxydecyl)amino]pentanoylsulfanyl]ethyl]piperazin-1-yl]ethyl] 5-[bis(2-hydroxydecyl)amino]pentanethioate |
|---|---|
| PubChem CID | 166078411 |
| Molecular Formula | C58H116N4O6S2 |
| Molecular Weight | 1029.72 g/mol |
| Exact Mass | 1028.83 |
| IUPAC Name | S-[2-[4-[2-[5-[bis(2-hydroxydecyl)amino]pentanoylsulfanyl]ethyl]piperazin-1-yl]ethyl] 5-[bis(2-hydroxydecyl)amino]pentanethioate |
| SMILES | CCCCCCCCC(O)CN(CCCCC(=O)SCCN1CCN(CCSC(=O)CCCCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)CC1)CC(O)CCCCCCCC |
| InChI | InChI=1S/C58H116N4O6S2/c1-5-9-13-17-21-25-33-53(63)49-61(50-54(64)34-26-22-18-14-10-6-2)39-31-29-37-57(67)69-47-45-59-41-43-60(44-42-59)46-48-70-58(68)38-30-32-40-62(51-55(65)35-27-23-19-15-11-7-3)52-56(66)36-28-24-20-16-12-8-4/h53-56,63-66H,5-52H2,1-4H3 |
| InChIKey | HTHNRAFYFLXMNU-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 128.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.72 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|