C56H112N4O7S — CID 166078585
2-[4-[2-[4-[bis(2-hydroxydecyl)amino]butanoylsulfanyl]ethyl]piperazin-1-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate (PubChem CID 166078585) has the molecular formula C56H112N4O7S and a molecular weight of 985.60 g/mol. Its IUPAC name is 2-[4-[2-[4-[bis(2-hydroxydecyl)amino]butanoylsulfanyl]ethyl]piperazin-1-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate.
| Compound Name | 2-[4-[2-[4-[bis(2-hydroxydecyl)amino]butanoylsulfanyl]ethyl]piperazin-1-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate |
|---|---|
| PubChem CID | 166078585 |
| Molecular Formula | C56H112N4O7S |
| Molecular Weight | 985.60 g/mol |
| Exact Mass | 984.83 |
| IUPAC Name | 2-[4-[2-[4-[bis(2-hydroxydecyl)amino]butanoylsulfanyl]ethyl]piperazin-1-yl]ethyl 4-[bis(2-hydroxydecyl)amino]butanoate |
| SMILES | CCCCCCCCC(O)CN(CCCC(=O)OCCN1CCN(CCSC(=O)CCCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)CC1)CC(O)CCCCCCCC |
| InChI | InChI=1S/C56H112N4O7S/c1-5-9-13-17-21-25-31-51(61)47-59(48-52(62)32-26-22-18-14-10-6-2)37-29-35-55(65)67-45-43-57-39-41-58(42-40-57)44-46-68-56(66)36-30-38-60(49-53(63)33-27-23-19-15-11-7-3)50-54(64)34-28-24-20-16-12-8-4/h51-54,61-64H,5-50H2,1-4H3 |
| InChIKey | RTXLXKLYLUGZDF-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.60 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|