C8H8N4O2 — CID 166078724
5,7-dimethyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 166078724) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 5,7-dimethyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5,7-dimethyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 166078724 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 5,7-dimethyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cc2ncnn2c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N4O2/c1-5-3-7-9-4-10-11(7)6(2)8(5)12(13)14/h3-4H,1-2H3 |
| InChIKey | WAIKNSWIBQWCNJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|