C15H22N3O+ — CID 166081925
4-[1-(1,1-dimethylbenzimidazol-1-ium-4-yl)ethyl]morpholine (PubChem CID 166081925) has the molecular formula C15H22N3O+ and a molecular weight of 260.36 g/mol. Its IUPAC name is 4-[1-(1,1-dimethylbenzimidazol-1-ium-4-yl)ethyl]morpholine.
| Compound Name | 4-[1-(1,1-dimethylbenzimidazol-1-ium-4-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 166081925 |
| Molecular Formula | C15H22N3O+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 4-[1-(1,1-dimethylbenzimidazol-1-ium-4-yl)ethyl]morpholine |
| SMILES | CC(c1cccc2c1N=C[N+]2(C)C)N1CCOCC1 |
| InChI | InChI=1S/C15H22N3O/c1-12(17-7-9-19-10-8-17)13-5-4-6-14-15(13)16-11-18(14,2)3/h4-6,11-12H,7-10H2,1-3H3/q+1 |
| InChIKey | ONPVEGNYZKQBTB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|