C14H20N3+ — CID 166081950
1,1-dimethyl-4-(pyrrolidin-1-ylmethyl)benzimidazol-1-ium (PubChem CID 166081950) has the molecular formula C14H20N3+ and a molecular weight of 230.34 g/mol. Its IUPAC name is 1,1-dimethyl-4-(pyrrolidin-1-ylmethyl)benzimidazol-1-ium.
| Compound Name | 1,1-dimethyl-4-(pyrrolidin-1-ylmethyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 166081950 |
| Molecular Formula | C14H20N3+ |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1,1-dimethyl-4-(pyrrolidin-1-ylmethyl)benzimidazol-1-ium |
| SMILES | C[N+]1(C)C=Nc2c(CN3CCCC3)cccc21 |
| InChI | InChI=1S/C14H20N3/c1-17(2)11-15-14-12(6-5-7-13(14)17)10-16-8-3-4-9-16/h5-7,11H,3-4,8-10H2,1-2H3/q+1 |
| InChIKey | PTEKGCYGVQXHBS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|