C8H11N — CID 166084214
1-cyclopropyl-N-methylbuta-2,3-dien-1-imine (PubChem CID 166084214) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 1-cyclopropyl-N-methylbuta-2,3-dien-1-imine.
| Compound Name | 1-cyclopropyl-N-methylbuta-2,3-dien-1-imine |
|---|---|
| PubChem CID | 166084214 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 1-cyclopropyl-N-methylbuta-2,3-dien-1-imine |
| SMILES | C=C=C/C(=N\C)C1CC1 |
| InChI | InChI=1S/C8H11N/c1-3-4-8(9-2)7-5-6-7/h4,7H,1,5-6H2,2H3/b9-8+ |
| InChIKey | IJGHCOPTIDWXTJ-CMDGGOBGSA-N |
| XLogP | 1.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|