C11H19N — CID 176925654
(Z)-1-cyclopropyl-N,3-dimethylhex-2-en-1-imine (PubChem CID 176925654) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (Z)-1-cyclopropyl-N,3-dimethylhex-2-en-1-imine.
| Compound Name | (Z)-1-cyclopropyl-N,3-dimethylhex-2-en-1-imine |
|---|---|
| PubChem CID | 176925654 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (Z)-1-cyclopropyl-N,3-dimethylhex-2-en-1-imine |
| SMILES | CCC/C(C)=C\C(=N\C)C1CC1 |
| InChI | InChI=1S/C11H19N/c1-4-5-9(2)8-11(12-3)10-6-7-10/h8,10H,4-7H2,1-3H3/b9-8-,12-11- |
| InChIKey | GLKJRCHZMXDPHU-MURFETPASA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|