C10H17FNP — CID 177146534
(E)-1-cyclopropyl-4-fluoro-N,3-dimethyl-4-phosphanylpent-2-en-1-imine (PubChem CID 177146534) has the molecular formula C10H17FNP and a molecular weight of 201.22 g/mol. Its IUPAC name is (E)-1-cyclopropyl-4-fluoro-N,3-dimethyl-4-phosphanylpent-2-en-1-imine.
| Compound Name | (E)-1-cyclopropyl-4-fluoro-N,3-dimethyl-4-phosphanylpent-2-en-1-imine |
|---|---|
| PubChem CID | 177146534 |
| Molecular Formula | C10H17FNP |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | (E)-1-cyclopropyl-4-fluoro-N,3-dimethyl-4-phosphanylpent-2-en-1-imine |
| SMILES | C/N=C(/C=C(\C)C(C)(F)P)C1CC1 |
| InChI | InChI=1S/C10H17FNP/c1-7(10(2,11)13)6-9(12-3)8-4-5-8/h6,8H,4-5,13H2,1-3H3/b7-6+,12-9- |
| InChIKey | URBVSBCJBQBDQK-XGHSRDQLSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|