C55H30B11N — CID 166084787
CID 166084787 (PubChem CID 166084787) has the molecular formula C55H30B11N and a molecular weight of 823.78 g/mol.
| Compound Name | CID 166084787 |
|---|---|
| PubChem CID | 166084787 |
| Molecular Formula | C55H30B11N |
| Molecular Weight | 823.78 g/mol |
| Exact Mass | 825.34 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(c([B])c1[B])-c1c(cc([B])c([B])c1[B])C21c2cc([B])c([B])c([B])c2-c2c([B])c([B])cc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c21 |
| InChI | InChI=1S/C55H30B11N/c1-53(2)29-11-7-5-9-25(29)27-15-13-23(17-31(27)53)67(24-14-16-28-26-10-6-8-12-30(26)54(3,4)32(28)18-24)40-22-39(59)46(60)44-43-35(21-38(58)49(63)52(43)66)55(45(40)44)33-19-36(56)47(61)50(64)41(33)42-34(55)20-37(57)48(62)51(42)65/h5-22H,1-4H3 |
| InChIKey | VULCNKGUFZRAIN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 67 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.78 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|