C20H31ClN4O — CID 166085067
2-chloro-4-[4-(2,6-diazaspiro[3.3]heptan-2-yl)piperidin-1-yl]benzaldehyde;N,N-dimethylmethanamine (PubChem CID 166085067) has the molecular formula C20H31ClN4O and a molecular weight of 378.95 g/mol. Its IUPAC name is 2-chloro-4-[4-(2,6-diazaspiro[3.3]heptan-2-yl)piperidin-1-yl]benzaldehyde;N,N-dimethylmethanamine.
| Compound Name | 2-chloro-4-[4-(2,6-diazaspiro[3.3]heptan-2-yl)piperidin-1-yl]benzaldehyde;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 166085067 |
| Molecular Formula | C20H31ClN4O |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-chloro-4-[4-(2,6-diazaspiro[3.3]heptan-2-yl)piperidin-1-yl]benzaldehyde;N,N-dimethylmethanamine |
| SMILES | CN(C)C.O=Cc1ccc(N2CCC(N3CC4(CNC4)C3)CC2)cc1Cl |
| InChI | InChI=1S/C17H22ClN3O.C3H9N/c18-16-7-15(2-1-13(16)8-22)20-5-3-14(4-6-20)21-11-17(12-21)9-19-10-17;1-4(2)3/h1-2,7-8,14,19H,3-6,9-12H2;1-3H3 |
| InChIKey | CZIWTXHKEGTCQA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|